C14H21N — CID 58339600
2,4,6-trimethyl-N-(3-methylbut-2-enyl)aniline (PubChem CID 58339600) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-(3-methylbut-2-enyl)aniline.
| Compound Name | 2,4,6-trimethyl-N-(3-methylbut-2-enyl)aniline |
|---|---|
| PubChem CID | 58339600 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2,4,6-trimethyl-N-(3-methylbut-2-enyl)aniline |
| SMILES | CC(C)=CCNc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H21N/c1-10(2)6-7-15-14-12(4)8-11(3)9-13(14)5/h6,8-9,15H,7H2,1-5H3 |
| InChIKey | ROBFYUPPCZULQJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|