C16H17FO — CID 143947874
[2-ethenyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-methylphenyl] hypofluorite (PubChem CID 143947874) has the molecular formula C16H17FO and a molecular weight of 244.31 g/mol. Its IUPAC name is [2-ethenyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-methylphenyl] hypofluorite.
| Compound Name | [2-ethenyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-methylphenyl] hypofluorite |
|---|---|
| PubChem CID | 143947874 |
| Molecular Formula | C16H17FO |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [2-ethenyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]-6-methylphenyl] hypofluorite |
| SMILES | C=C/C=C(\C=C)Cc1cc(C)c(OF)c(C=C)c1 |
| InChI | InChI=1S/C16H17FO/c1-5-8-13(6-2)10-14-9-12(4)16(18-17)15(7-3)11-14/h5-9,11H,1-3,10H2,4H3/b13-8+ |
| InChIKey | HZTXCSIDIYZBME-MDWZMJQESA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|