C8H9F — CID 143823986
3-ethenyl-4-fluorohexa-1,3,5-triene (PubChem CID 143823986) has the molecular formula C8H9F and a molecular weight of 124.16 g/mol. Its IUPAC name is 3-ethenyl-4-fluorohexa-1,3,5-triene.
| Compound Name | 3-ethenyl-4-fluorohexa-1,3,5-triene |
|---|---|
| PubChem CID | 143823986 |
| Molecular Formula | C8H9F |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 3-ethenyl-4-fluorohexa-1,3,5-triene |
| SMILES | C=CC(F)=C(C=C)C=C |
| InChI | InChI=1S/C8H9F/c1-4-7(5-2)8(9)6-3/h4-6H,1-3H2 |
| InChIKey | BPDIYQCHYPKHSM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|