About vinylsiloxanol
vinylsiloxanol (PubChem CID 18696394) has the molecular formula C2H5O2Si
and a molecular weight of 89.15 g/mol.
Molecular Properties
| Compound Name | vinylsiloxanol |
|---|
| PubChem CID | 18696394 |
|---|
| Molecular Formula | C2H5O2Si |
|---|
| Molecular Weight | 89.15 g/mol |
|---|
| Exact Mass | 89.01 |
|---|
| IUPAC Name | — |
|---|
| SMILES | C=C[Si](O)O |
|---|
| InChI | InChI=1S/C2H5O2Si/c1-2-5(3)4/h2-4H,1H2 |
|---|
| InChIKey | UQEADCIFBIDPSJ-UHFFFAOYSA-N |
|---|
| XLogP | -0.82 |
|---|
| TPSA | 40.46 Ų |
|---|
| H-Bond Donors | 2 |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 5 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 89.15 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze vinylsiloxanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of vinylsiloxanol?
The IUPAC name of vinylsiloxanol (CID 18696394) is not available.
What is the SMILES notation for vinylsiloxanol?
The canonical SMILES for vinylsiloxanol is C=C[Si](O)O.
What is the InChIKey of vinylsiloxanol?
The InChIKey is UQEADCIFBIDPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5O2Si/c1-2-5(3)4/h2-4H,1H2.
What are the key properties of vinylsiloxanol?
vinylsiloxanol has a molecular weight of 89.15 g/mol, XLogP of -0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for vinylsiloxanol is sourced from PubChem (CID 18696394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).