About CID 169101876
CID 169101876 (PubChem CID 169101876) has the molecular formula C6H11O3Si
and a molecular weight of 159.24 g/mol.
Molecular Properties
| Compound Name | CID 169101876 |
| PubChem CID | 169101876 |
| Molecular Formula | C6H11O3Si |
| Molecular Weight | 159.24 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | — |
| SMILES | C=CCO[Si](O)OCC=C |
| InChI | InChI=1S/C6H11O3Si/c1-3-5-8-10(7)9-6-4-2/h3-4,7H,1-2,5-6H2 |
| InChIKey | ZJHFIWQGEOWCAJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 169101876 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169101876?
The IUPAC name of CID 169101876 (CID 169101876) is not available.
What is the SMILES notation for CID 169101876?
The canonical SMILES for CID 169101876 is C=CCO[Si](O)OCC=C.
What is the InChIKey of CID 169101876?
The InChIKey is ZJHFIWQGEOWCAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O3Si/c1-3-5-8-10(7)9-6-4-2/h3-4,7H,1-2,5-6H2.
What are the key properties of CID 169101876?
CID 169101876 has a molecular weight of 159.24 g/mol, XLogP of 0.37, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169101876 is sourced from PubChem (CID 169101876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).