About Diisopropyl(allyloxy) silane
Diisopropyl(allyloxy) silane (PubChem CID 6329357) has the molecular formula C9H19OSi
and a molecular weight of 171.34 g/mol.
Molecular Properties
| Compound Name | Diisopropyl(allyloxy) silane |
| PubChem CID | 6329357 |
| Molecular Formula | C9H19OSi |
| Molecular Weight | 171.34 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | — |
| SMILES | C=CCO[Si](C(C)C)C(C)C |
| InChI | InChI=1S/C9H19OSi/c1-6-7-10-11(8(2)3)9(4)5/h6,8-9H,1,7H2,2-5H3 |
| InChIKey | SBXZBRUQKWWFGS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Diisopropyl(allyloxy) silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diisopropyl(allyloxy) silane?
The IUPAC name of Diisopropyl(allyloxy) silane (CID 6329357) is not available.
What is the SMILES notation for Diisopropyl(allyloxy) silane?
The canonical SMILES for Diisopropyl(allyloxy) silane is C=CCO[Si](C(C)C)C(C)C.
What is the InChIKey of Diisopropyl(allyloxy) silane?
The InChIKey is SBXZBRUQKWWFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19OSi/c1-6-7-10-11(8(2)3)9(4)5/h6,8-9H,1,7H2,2-5H3.
What are the key properties of Diisopropyl(allyloxy) silane?
Diisopropyl(allyloxy) silane has a molecular weight of 171.34 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Diisopropyl(allyloxy) silane is sourced from PubChem (CID 6329357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).