About Mercury, bis(ethenyldimethylsilyl)-
Mercury, bis(ethenyldimethylsilyl)- (PubChem CID 71323688) has the molecular formula C8H18HgSi2
and a molecular weight of 370.99 g/mol.
Molecular Properties
| Compound Name | Mercury, bis(ethenyldimethylsilyl)- |
| PubChem CID | 71323688 |
| Molecular Formula | C8H18HgSi2 |
| Molecular Weight | 370.99 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)C.C=C[Si](C)C.[Hg] |
| InChI | InChI=1S/2C4H9Si.Hg/c2*1-4-5(2)3;/h2*4H,1H2,2-3H3; |
| InChIKey | PTIMMWVPHGVGCC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.99 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Mercury, bis(ethenyldimethylsilyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mercury, bis(ethenyldimethylsilyl)-?
The IUPAC name of Mercury, bis(ethenyldimethylsilyl)- (CID 71323688) is not available.
What is the SMILES notation for Mercury, bis(ethenyldimethylsilyl)-?
The canonical SMILES for Mercury, bis(ethenyldimethylsilyl)- is C=C[Si](C)C.C=C[Si](C)C.[Hg].
What is the InChIKey of Mercury, bis(ethenyldimethylsilyl)-?
The InChIKey is PTIMMWVPHGVGCC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9Si.Hg/c2*1-4-5(2)3;/h2*4H,1H2,2-3H3;.
What are the key properties of Mercury, bis(ethenyldimethylsilyl)-?
Mercury, bis(ethenyldimethylsilyl)- has a molecular weight of 370.99 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Mercury, bis(ethenyldimethylsilyl)- is sourced from PubChem (CID 71323688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).