About CID 57041783
CID 57041783 (PubChem CID 57041783) has the molecular formula C4H8ClSi
and a molecular weight of 119.65 g/mol.
Molecular Properties
| Compound Name | CID 57041783 |
| PubChem CID | 57041783 |
| Molecular Formula | C4H8ClSi |
| Molecular Weight | 119.65 g/mol |
| Exact Mass | 119.01 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)CCl |
| InChI | InChI=1S/C4H8ClSi/c1-3-6(2)4-5/h3H,1,4H2,2H3 |
| InChIKey | BYMPBYXHUJPMHT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57041783 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57041783?
The IUPAC name of CID 57041783 (CID 57041783) is not available.
What is the SMILES notation for CID 57041783?
The canonical SMILES for CID 57041783 is C=C[Si](C)CCl.
What is the InChIKey of CID 57041783?
The InChIKey is BYMPBYXHUJPMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClSi/c1-3-6(2)4-5/h3H,1,4H2,2H3.
What are the key properties of CID 57041783?
CID 57041783 has a molecular weight of 119.65 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57041783 is sourced from PubChem (CID 57041783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).