About CID 173291298
CID 173291298 (PubChem CID 173291298) has the molecular formula C10H24Cl2N2Si2Zr
and a molecular weight of 390.62 g/mol.
Molecular Properties
| Compound Name | CID 173291298 |
| PubChem CID | 173291298 |
| Molecular Formula | C10H24Cl2N2Si2Zr |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | — |
| SMILES | C=CCN[Si](C)C.C=CCN[Si](C)C.Cl[Zr]Cl |
| InChI | InChI=1S/2C5H12NSi.2ClH.Zr/c2*1-4-5-6-7(2)3;;;/h2*4,6H,1,5H2,2-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | PKKMFOZGMBVPPK-UHFFFAOYSA-L |
| XLogP | 3.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 173291298 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173291298?
The IUPAC name of CID 173291298 (CID 173291298) is not available.
What is the SMILES notation for CID 173291298?
The canonical SMILES for CID 173291298 is C=CCN[Si](C)C.C=CCN[Si](C)C.Cl[Zr]Cl.
What is the InChIKey of CID 173291298?
The InChIKey is PKKMFOZGMBVPPK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H12NSi.2ClH.Zr/c2*1-4-5-6-7(2)3;;;/h2*4,6H,1,5H2,2-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 173291298?
CID 173291298 has a molecular weight of 390.62 g/mol, XLogP of 3.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173291298 is sourced from PubChem (CID 173291298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).