C9H11F2IO — CID 166907268
(2Z,4Z)-1,1-difluoro-1-iodo-2,5-dimethylhepta-2,4,6-trien-3-ol (PubChem CID 166907268) has the molecular formula C9H11F2IO and a molecular weight of 300.09 g/mol. Its IUPAC name is (2Z,4Z)-1,1-difluoro-1-iodo-2,5-dimethylhepta-2,4,6-trien-3-ol.
| Compound Name | (2Z,4Z)-1,1-difluoro-1-iodo-2,5-dimethylhepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 166907268 |
| Molecular Formula | C9H11F2IO |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | (2Z,4Z)-1,1-difluoro-1-iodo-2,5-dimethylhepta-2,4,6-trien-3-ol |
| SMILES | C=C/C(C)=C\C(O)=C(/C)C(F)(F)I |
| InChI | InChI=1S/C9H11F2IO/c1-4-6(2)5-8(13)7(3)9(10,11)12/h4-5,13H,1H2,2-3H3/b6-5-,8-7- |
| InChIKey | WVVGKUUXMFICKB-ISTTXYCBSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|