C18H32FN — CID 144773838
(4Z,6Z)-6-but-3-en-2-ylidene-9-fluoro-9-methyldeca-1,4-diene;N,N-dimethylmethanamine (PubChem CID 144773838) has the molecular formula C18H32FN and a molecular weight of 281.46 g/mol. Its IUPAC name is (4Z,6Z)-6-but-3-en-2-ylidene-9-fluoro-9-methyldeca-1,4-diene;N,N-dimethylmethanamine.
| Compound Name | (4Z,6Z)-6-but-3-en-2-ylidene-9-fluoro-9-methyldeca-1,4-diene;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 144773838 |
| Molecular Formula | C18H32FN |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | (4Z,6Z)-6-but-3-en-2-ylidene-9-fluoro-9-methyldeca-1,4-diene;N,N-dimethylmethanamine |
| SMILES | C=CC/C=C\C(CCC(C)(C)F)=C(\C)C=C.CN(C)C |
| InChI | InChI=1S/C15H23F.C3H9N/c1-6-8-9-10-14(13(3)7-2)11-12-15(4,5)16;1-4(2)3/h6-7,9-10H,1-2,8,11-12H2,3-5H3;1-3H3/b10-9-,14-13+; |
| InChIKey | GHKSPPXXDGDZTP-YRAGAKFNSA-N |
| XLogP | 5.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|