About N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane
N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane (PubChem CID 174452092) has the molecular formula C6H12F3NOSi
and a molecular weight of 199.25 g/mol. Its IUPAC name is N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane.
Molecular Properties
| Compound Name | N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane |
| PubChem CID | 174452092 |
| Molecular Formula | C6H12F3NOSi |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane |
| SMILES | C=CCN(C(C)=O)C(F)(F)F.[SiH4] |
| InChI | InChI=1S/C6H8F3NO.H4Si/c1-3-4-10(5(2)11)6(7,8)9;/h3H,1,4H2,2H3;1H4 |
| InChIKey | CVSGCJDWKUYAQC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane?
The IUPAC name of N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane (CID 174452092) is N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane.
What is the SMILES notation for N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane?
The canonical SMILES for N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane is C=CCN(C(C)=O)C(F)(F)F.[SiH4].
What is the InChIKey of N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane?
The InChIKey is CVSGCJDWKUYAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO.H4Si/c1-3-4-10(5(2)11)6(7,8)9;/h3H,1,4H2,2H3;1H4.
What are the key properties of N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane?
N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane has a molecular weight of 199.25 g/mol, XLogP of 0.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-N-(trifluoromethyl)acetamide;silane is sourced from PubChem (CID 174452092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).