C14H27NO3 — CID 177240117
N-[1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]-N-prop-2-enylacetamide (PubChem CID 177240117) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is N-[1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]-N-prop-2-enylacetamide.
| Compound Name | N-[1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 177240117 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | N-[1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(C)=O)C(C)(C)COCC(C)(C)CO |
| InChI | InChI=1S/C14H27NO3/c1-7-8-15(12(2)17)14(5,6)11-18-10-13(3,4)9-16/h7,16H,1,8-11H2,2-6H3 |
| InChIKey | KZLGDVFYVNFVHH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|