About [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate
[(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate (PubChem CID 177106046) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate |
| PubChem CID | 177106046 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)O/C=C/C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C12H19NO3/c1-6-8-13(12(3,4)5)11(15)16-9-7-10(2)14/h6-7,9H,1,8H2,2-5H3/b9-7+ |
| InChIKey | FKVBAGAQFNMHCL-VQHVLOKHSA-N |
| XLogP | 2.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate?
The IUPAC name of [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate (CID 177106046) is [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate.
What is the SMILES notation for [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate?
The canonical SMILES for [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate is C=CCN(C(=O)O/C=C/C(C)=O)C(C)(C)C.
What is the InChIKey of [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate?
The InChIKey is FKVBAGAQFNMHCL-VQHVLOKHSA-N. The full InChI is InChI=1S/C12H19NO3/c1-6-8-13(12(3,4)5)11(15)16-9-7-10(2)14/h6-7,9H,1,8H2,2-5H3/b9-7+.
What are the key properties of [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate?
[(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate has a molecular weight of 225.29 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-oxobut-1-enyl] N-tert-butyl-N-prop-2-enylcarbamate is sourced from PubChem (CID 177106046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).