C13H22O6 — CID 141231799
4-(3-hydroxy-2,2-dimethylpropoxy)carbonyloxybutyl prop-2-enoate (PubChem CID 141231799) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 4-(3-hydroxy-2,2-dimethylpropoxy)carbonyloxybutyl prop-2-enoate.
| Compound Name | 4-(3-hydroxy-2,2-dimethylpropoxy)carbonyloxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 141231799 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-(3-hydroxy-2,2-dimethylpropoxy)carbonyloxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)OCC(C)(C)CO |
| InChI | InChI=1S/C13H22O6/c1-4-11(15)17-7-5-6-8-18-12(16)19-10-13(2,3)9-14/h4,14H,1,5-10H2,2-3H3 |
| InChIKey | UGPFYVKXZOFALV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|