C11H19F3 — CID 142269776
ethane;(3E)-4-ethyl-6,6,6-trifluoro-5-methylhexa-1,3-diene (PubChem CID 142269776) has the molecular formula C11H19F3 and a molecular weight of 208.27 g/mol. Its IUPAC name is ethane;(3E)-4-ethyl-6,6,6-trifluoro-5-methylhexa-1,3-diene.
| Compound Name | ethane;(3E)-4-ethyl-6,6,6-trifluoro-5-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 142269776 |
| Molecular Formula | C11H19F3 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | ethane;(3E)-4-ethyl-6,6,6-trifluoro-5-methylhexa-1,3-diene |
| SMILES | C=C/C=C(\CC)C(C)C(F)(F)F.CC |
| InChI | InChI=1S/C9H13F3.C2H6/c1-4-6-8(5-2)7(3)9(10,11)12;1-2/h4,6-7H,1,5H2,2-3H3;1-2H3/b8-6+; |
| InChIKey | VZOLYHBPUDJHNL-WVLIHFOGSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|