C13H22O — CID 178057179
(3Z,5E)-5-methoxy-4-(2-methylbutan-2-yl)hepta-1,3,5-triene (PubChem CID 178057179) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (3Z,5E)-5-methoxy-4-(2-methylbutan-2-yl)hepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-methoxy-4-(2-methylbutan-2-yl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 178057179 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (3Z,5E)-5-methoxy-4-(2-methylbutan-2-yl)hepta-1,3,5-triene |
| SMILES | C=C/C=C(C(=C/C)\OC)/C(C)(C)CC |
| InChI | InChI=1S/C13H22O/c1-7-10-11(12(8-2)14-6)13(4,5)9-3/h7-8,10H,1,9H2,2-6H3/b11-10+,12-8+ |
| InChIKey | IOKGINQLLRAUGL-HKCCEGKBSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|