C14H25N — CID 137392045
N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]methanimine (PubChem CID 137392045) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]methanimine.
| Compound Name | N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 137392045 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]methanimine |
| SMILES | C=C/C=C(\C)C(C)(CC)C(C)(CC)N=C |
| InChI | InChI=1S/C14H25N/c1-8-11-12(4)13(5,9-2)14(6,10-3)15-7/h8,11H,1,7,9-10H2,2-6H3/b12-11+ |
| InChIKey | GVCDGQRMFJCVJN-VAWYXSNFSA-N |
| XLogP | 4.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|