C19H33N — CID 139452636
N-[(5E,7E)-4-ethyl-3,4,6,7-tetramethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-3-yl]methanimine (PubChem CID 139452636) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is N-[(5E,7E)-4-ethyl-3,4,6,7-tetramethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-3-yl]methanimine.
| Compound Name | N-[(5E,7E)-4-ethyl-3,4,6,7-tetramethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 139452636 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N-[(5E,7E)-4-ethyl-3,4,6,7-tetramethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-3-yl]methanimine |
| SMILES | C=NC(C)(CC)C(C)(CC)C(/C=C\C)=C(C)/C(C)=C/C |
| InChI | InChI=1S/C19H33N/c1-10-14-17(16(6)15(5)11-2)18(7,12-3)19(8,13-4)20-9/h10-11,14H,9,12-13H2,1-8H3/b14-10-,15-11+,17-16+ |
| InChIKey | DLRZJDMOVYFEKU-JCRFBKOWSA-N |
| XLogP | 6.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|