C7H7ClF3N — CID 162583769
N-[(1Z,3Z)-1-chloro-2-(trifluoromethyl)penta-1,3-dienyl]methanimine (PubChem CID 162583769) has the molecular formula C7H7ClF3N and a molecular weight of 197.59 g/mol. Its IUPAC name is N-[(1Z,3Z)-1-chloro-2-(trifluoromethyl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-1-chloro-2-(trifluoromethyl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 162583769 |
| Molecular Formula | C7H7ClF3N |
| Molecular Weight | 197.59 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | N-[(1Z,3Z)-1-chloro-2-(trifluoromethyl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C(Cl)=C(\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C7H7ClF3N/c1-3-4-5(6(8)12-2)7(9,10)11/h3-4H,2H2,1H3/b4-3-,6-5+ |
| InChIKey | ATKFJVYQWDHTHP-DNVGVPOPSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|