About N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride
N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride (PubChem CID 171929825) has the molecular formula C6H5Cl2F3N2
and a molecular weight of 233.02 g/mol. Its IUPAC name is N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride.
Molecular Properties
| Compound Name | N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride |
| PubChem CID | 171929825 |
| Molecular Formula | C6H5Cl2F3N2 |
| Molecular Weight | 233.02 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride |
| SMILES | C=NC(Cl)=N/C(Cl)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C6H5Cl2F3N2/c1-3(6(9,10)11)4(7)13-5(8)12-2/h2H2,1H3/b4-3+,13-5? |
| InChIKey | YJUNIQHXFYIWBO-SFIGNQLXSA-N |
| XLogP | 3.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.02 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride?
The IUPAC name of N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride (CID 171929825) is N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride.
What is the SMILES notation for N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride?
The canonical SMILES for N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride is C=NC(Cl)=N/C(Cl)=C(\C)C(F)(F)F.
What is the InChIKey of N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride?
The InChIKey is YJUNIQHXFYIWBO-SFIGNQLXSA-N. The full InChI is InChI=1S/C6H5Cl2F3N2/c1-3(6(9,10)11)4(7)13-5(8)12-2/h2H2,1H3/b4-3+,13-5?.
What are the key properties of N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride?
N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride has a molecular weight of 233.02 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride is sourced from PubChem (CID 171929825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).