C6H5Cl2F3N2 — CID 171929825
N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride (PubChem CID 171929825) has the molecular formula C6H5Cl2F3N2 and a molecular weight of 233.02 g/mol. Its IUPAC name is N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride.
| Compound Name | N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride |
|---|---|
| PubChem CID | 171929825 |
| Molecular Formula | C6H5Cl2F3N2 |
| Molecular Weight | 233.02 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | N'-[(Z)-1-chloro-3,3,3-trifluoro-2-methylprop-1-enyl]-N-methylidenecarbamimidoyl chloride |
| SMILES | C=NC(Cl)=N/C(Cl)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C6H5Cl2F3N2/c1-3(6(9,10)11)4(7)13-5(8)12-2/h2H2,1H3/b4-3+,13-5? |
| InChIKey | YJUNIQHXFYIWBO-SFIGNQLXSA-N |
| XLogP | 3.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.02 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|