C9H11F4N — CID 167254228
N-[(2E)-4-fluoro-3-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine (PubChem CID 167254228) has the molecular formula C9H11F4N and a molecular weight of 209.19 g/mol. Its IUPAC name is N-[(2E)-4-fluoro-3-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine.
| Compound Name | N-[(2E)-4-fluoro-3-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 167254228 |
| Molecular Formula | C9H11F4N |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | N-[(2E)-4-fluoro-3-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine |
| SMILES | C=C(F)/C(=C(/C)N=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H11F4N/c1-5(2)14-7(4)8(6(3)10)9(11,12)13/h3H2,1-2,4H3/b8-7+ |
| InChIKey | KJLFHZKVFVDVCO-BQYQJAHWSA-N |
| XLogP | 3.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|