C13H9F7O2 — CID 143575227
[(3Z,5Z)-2,4,5,7-tetrafluoro-6-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl] 2-methylprop-2-enoate (PubChem CID 143575227) has the molecular formula C13H9F7O2 and a molecular weight of 330.20 g/mol. Its IUPAC name is [(3Z,5Z)-2,4,5,7-tetrafluoro-6-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl] 2-methylprop-2-enoate.
| Compound Name | [(3Z,5Z)-2,4,5,7-tetrafluoro-6-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143575227 |
| Molecular Formula | C13H9F7O2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | [(3Z,5Z)-2,4,5,7-tetrafluoro-6-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O/C(C(=C)F)=C(F)/C(F)=C(\C(=C)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F7O2/c1-5(2)12(21)22-11(7(4)15)10(17)9(16)8(6(3)14)13(18,19)20/h1,3-4H2,2H3/b9-8-,11-10- |
| InChIKey | OPKMTYVKVCVQFX-XESWYYRISA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|