C10H15F3 — CID 137451352
5,5-dimethyl-4-methylidene-2-(trifluoromethyl)hex-1-ene (PubChem CID 137451352) has the molecular formula C10H15F3 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5,5-dimethyl-4-methylidene-2-(trifluoromethyl)hex-1-ene.
| Compound Name | 5,5-dimethyl-4-methylidene-2-(trifluoromethyl)hex-1-ene |
|---|---|
| PubChem CID | 137451352 |
| Molecular Formula | C10H15F3 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 5,5-dimethyl-4-methylidene-2-(trifluoromethyl)hex-1-ene |
| SMILES | C=C(CC(=C)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C10H15F3/c1-7(9(3,4)5)6-8(2)10(11,12)13/h1-2,6H2,3-5H3 |
| InChIKey | WWVRSIMRMOCBCG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|