C7H6F3NS2 — CID 162275903
2,3-bis(sulfanyl)-5-(trifluoromethyl)hexa-2,5-dienenitrile (PubChem CID 162275903) has the molecular formula C7H6F3NS2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)-5-(trifluoromethyl)hexa-2,5-dienenitrile.
| Compound Name | 2,3-bis(sulfanyl)-5-(trifluoromethyl)hexa-2,5-dienenitrile |
|---|---|
| PubChem CID | 162275903 |
| Molecular Formula | C7H6F3NS2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2,3-bis(sulfanyl)-5-(trifluoromethyl)hexa-2,5-dienenitrile |
| SMILES | C=C(CC(S)=C(S)C#N)C(F)(F)F |
| InChI | InChI=1S/C7H6F3NS2/c1-4(7(8,9)10)2-5(12)6(13)3-11/h12-13H,1-2H2 |
| InChIKey | WERIOZQXBGILSN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|