C7H7F7 — CID 58936765
4,5,5,5-tetrafluoro-4-methyl-2-(trifluoromethyl)pent-1-ene (PubChem CID 58936765) has the molecular formula C7H7F7 and a molecular weight of 224.12 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-4-methyl-2-(trifluoromethyl)pent-1-ene.
| Compound Name | 4,5,5,5-tetrafluoro-4-methyl-2-(trifluoromethyl)pent-1-ene |
|---|---|
| PubChem CID | 58936765 |
| Molecular Formula | C7H7F7 |
| Molecular Weight | 224.12 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 4,5,5,5-tetrafluoro-4-methyl-2-(trifluoromethyl)pent-1-ene |
| SMILES | C=C(CC(C)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7F7/c1-4(6(9,10)11)3-5(2,8)7(12,13)14/h1,3H2,2H3 |
| InChIKey | IRCLSLDAPYVUHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|