C6H6F6O — CID 162534784
1,1,1-trifluoro-2-methyl-3-(trifluoromethyl)but-3-en-2-ol (PubChem CID 162534784) has the molecular formula C6H6F6O and a molecular weight of 208.10 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-methyl-3-(trifluoromethyl)but-3-en-2-ol.
| Compound Name | 1,1,1-trifluoro-2-methyl-3-(trifluoromethyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 162534784 |
| Molecular Formula | C6H6F6O |
| Molecular Weight | 208.10 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1,1,1-trifluoro-2-methyl-3-(trifluoromethyl)but-3-en-2-ol |
| SMILES | C=C(C(F)(F)F)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C6H6F6O/c1-3(5(7,8)9)4(2,13)6(10,11)12/h13H,1H2,2H3 |
| InChIKey | OEMLKCOYPJRXOJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.10 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|