C12H14F6 — CID 162429980
(3E,5Z)-3-propan-2-yl-2,4-bis(trifluoromethyl)hepta-1,3,5-triene (PubChem CID 162429980) has the molecular formula C12H14F6 and a molecular weight of 272.23 g/mol. Its IUPAC name is (3E,5Z)-3-propan-2-yl-2,4-bis(trifluoromethyl)hepta-1,3,5-triene.
| Compound Name | (3E,5Z)-3-propan-2-yl-2,4-bis(trifluoromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 162429980 |
| Molecular Formula | C12H14F6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (3E,5Z)-3-propan-2-yl-2,4-bis(trifluoromethyl)hepta-1,3,5-triene |
| SMILES | C=C(/C(=C(\C=C/C)C(F)(F)F)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H14F6/c1-5-6-9(12(16,17)18)10(7(2)3)8(4)11(13,14)15/h5-7H,4H2,1-3H3/b6-5-,10-9+ |
| InChIKey | ZHIOODNADSDXFI-MLCWLASSSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|