C13H25N — CID 130341594
N-[(E)-4-ethyl-3,4,5-trimethylhept-5-en-3-yl]methanimine (PubChem CID 130341594) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is N-[(E)-4-ethyl-3,4,5-trimethylhept-5-en-3-yl]methanimine.
| Compound Name | N-[(E)-4-ethyl-3,4,5-trimethylhept-5-en-3-yl]methanimine |
|---|---|
| PubChem CID | 130341594 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N-[(E)-4-ethyl-3,4,5-trimethylhept-5-en-3-yl]methanimine |
| SMILES | C=NC(C)(CC)C(C)(CC)/C(C)=C/C |
| InChI | InChI=1S/C13H25N/c1-8-11(4)12(5,9-2)13(6,10-3)14-7/h8H,7,9-10H2,1-6H3/b11-8+ |
| InChIKey | BUKLOTAOJGEZRA-DHZHZOJOSA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|