C15H27N — CID 146609918
N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-2,2-dimethylpentan-3-imine (PubChem CID 146609918) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-2,2-dimethylpentan-3-imine.
| Compound Name | N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-2,2-dimethylpentan-3-imine |
|---|---|
| PubChem CID | 146609918 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl]-2,2-dimethylpentan-3-imine |
| SMILES | C=C/C=C(\N=C(/CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-9-11-13(15(6,7)8)16-12(10-2)14(3,4)5/h9,11H,1,10H2,2-8H3/b13-11-,16-12+ |
| InChIKey | HQNBCGFCMCXYGL-FFKGAHPDSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|