C17H28N2 — CID 144953908
ethane;(5Z)-3-N-ethenyl-4-ethyl-5-N-ethylidene-4-methylocta-1,5,7-triene-3,5-diimine (PubChem CID 144953908) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is ethane;(5Z)-3-N-ethenyl-4-ethyl-5-N-ethylidene-4-methylocta-1,5,7-triene-3,5-diimine.
| Compound Name | ethane;(5Z)-3-N-ethenyl-4-ethyl-5-N-ethylidene-4-methylocta-1,5,7-triene-3,5-diimine |
|---|---|
| PubChem CID | 144953908 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | ethane;(5Z)-3-N-ethenyl-4-ethyl-5-N-ethylidene-4-methylocta-1,5,7-triene-3,5-diimine |
| SMILES | C=C/C=C(\N=C\C)C(C)(CC)/C(C=C)=N/C=C.CC |
| InChI | InChI=1S/C15H22N2.C2H6/c1-7-12-14(17-11-5)15(6,9-3)13(8-2)16-10-4;1-2/h7-8,10-12H,1-2,4,9H2,3,5-6H3;1-2H3/b14-12-,16-13+,17-11+; |
| InChIKey | KRKJWDQYPMGWJS-VORIVJMHSA-N |
| XLogP | 5.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|