C26H26N2 — CID 166955496
(3E)-N-(methylideneamino)-N-tritylhexa-3,5-dien-3-amine (PubChem CID 166955496) has the molecular formula C26H26N2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (3E)-N-(methylideneamino)-N-tritylhexa-3,5-dien-3-amine.
| Compound Name | (3E)-N-(methylideneamino)-N-tritylhexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 166955496 |
| Molecular Formula | C26H26N2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3E)-N-(methylideneamino)-N-tritylhexa-3,5-dien-3-amine |
| SMILES | C=C/C=C(\CC)N(N=C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2/c1-4-15-25(5-2)28(27-3)26(22-16-9-6-10-17-22,23-18-11-7-12-19-23)24-20-13-8-14-21-24/h4,6-21H,1,3,5H2,2H3/b25-15+ |
| InChIKey | APMHNHPZYGTEQJ-MFKUBSTISA-N |
| XLogP | 6.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|