C18H19P — CID 123633252
hexa-3,5-dien-3-yl(diphenyl)phosphane (PubChem CID 123633252) has the molecular formula C18H19P and a molecular weight of 266.32 g/mol. Its IUPAC name is hexa-3,5-dien-3-yl(diphenyl)phosphane.
| Compound Name | hexa-3,5-dien-3-yl(diphenyl)phosphane |
|---|---|
| PubChem CID | 123633252 |
| Molecular Formula | C18H19P |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | hexa-3,5-dien-3-yl(diphenyl)phosphane |
| SMILES | C=CC=C(CC)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19P/c1-3-11-16(4-2)19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h3,5-15H,1,4H2,2H3 |
| InChIKey | SWRBVCBBLLTNPL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|