About dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride
dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride (PubChem CID 159184721) has the molecular formula C22H29Cl4PTi
and a molecular weight of 514.13 g/mol. Its IUPAC name is dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride.
Molecular Properties
| Compound Name | dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride |
| PubChem CID | 159184721 |
| Molecular Formula | C22H29Cl4PTi |
| Molecular Weight | 514.13 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride |
| SMILES | CCCCC=C(CCCC)P(c1ccccc1)c1ccccc1.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C22H29P.4ClH.Ti/c1-3-5-9-15-20(14-6-4-2)23(21-16-10-7-11-17-21)22-18-12-8-13-19-22;;;;;/h7-8,10-13,15-19H,3-6,9,14H2,1-2H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | KNIMPQCKIHSFER-UHFFFAOYSA-J |
| XLogP | -5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.13 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride?
The IUPAC name of dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride (CID 159184721) is dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride.
What is the SMILES notation for dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride?
The canonical SMILES for dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride is CCCCC=C(CCCC)P(c1ccccc1)c1ccccc1.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride?
The InChIKey is KNIMPQCKIHSFER-UHFFFAOYSA-J. The full InChI is InChI=1S/C22H29P.4ClH.Ti/c1-3-5-9-15-20(14-6-4-2)23(21-16-10-7-11-17-21)22-18-12-8-13-19-22;;;;;/h7-8,10-13,15-19H,3-6,9,14H2,1-2H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride?
dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride has a molecular weight of 514.13 g/mol, XLogP of -5.60, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dec-5-en-5-yl(diphenyl)phosphane;titanium(4+);tetrachloride is sourced from PubChem (CID 159184721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).