About ethenoxyethane;triphenylphosphane
ethenoxyethane;triphenylphosphane (PubChem CID 175017576) has the molecular formula C22H23OP
and a molecular weight of 334.40 g/mol. Its IUPAC name is ethenoxyethane;triphenylphosphane.
Molecular Properties
| Compound Name | ethenoxyethane;triphenylphosphane |
| PubChem CID | 175017576 |
| Molecular Formula | C22H23OP |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | ethenoxyethane;triphenylphosphane |
| SMILES | C=COCC.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C4H8O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-4-2/h1-15H;3H,1,4H2,2H3 |
| InChIKey | DGXLWLLDXKLNSF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethane;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethane;triphenylphosphane?
The IUPAC name of ethenoxyethane;triphenylphosphane (CID 175017576) is ethenoxyethane;triphenylphosphane.
What is the SMILES notation for ethenoxyethane;triphenylphosphane?
The canonical SMILES for ethenoxyethane;triphenylphosphane is C=COCC.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ethenoxyethane;triphenylphosphane?
The InChIKey is DGXLWLLDXKLNSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C4H8O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-4-2/h1-15H;3H,1,4H2,2H3.
What are the key properties of ethenoxyethane;triphenylphosphane?
ethenoxyethane;triphenylphosphane has a molecular weight of 334.40 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethane;triphenylphosphane is sourced from PubChem (CID 175017576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).