About triphenylphosphane;tris(prop-2-enyl)phosphane
triphenylphosphane;tris(prop-2-enyl)phosphane (PubChem CID 175264539) has the molecular formula C27H30P2
and a molecular weight of 416.49 g/mol. Its IUPAC name is triphenylphosphane;tris(prop-2-enyl)phosphane.
Molecular Properties
| Compound Name | triphenylphosphane;tris(prop-2-enyl)phosphane |
| PubChem CID | 175264539 |
| Molecular Formula | C27H30P2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | triphenylphosphane;tris(prop-2-enyl)phosphane |
| SMILES | C=CCP(CC=C)CC=C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C9H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-7-10(8-5-2)9-6-3/h1-15H;4-6H,1-3,7-9H2 |
| InChIKey | QGDVEOQJXQDNAS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenylphosphane;tris(prop-2-enyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylphosphane;tris(prop-2-enyl)phosphane?
The IUPAC name of triphenylphosphane;tris(prop-2-enyl)phosphane (CID 175264539) is triphenylphosphane;tris(prop-2-enyl)phosphane.
What is the SMILES notation for triphenylphosphane;tris(prop-2-enyl)phosphane?
The canonical SMILES for triphenylphosphane;tris(prop-2-enyl)phosphane is C=CCP(CC=C)CC=C.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylphosphane;tris(prop-2-enyl)phosphane?
The InChIKey is QGDVEOQJXQDNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C9H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-7-10(8-5-2)9-6-3/h1-15H;4-6H,1-3,7-9H2.
What are the key properties of triphenylphosphane;tris(prop-2-enyl)phosphane?
triphenylphosphane;tris(prop-2-enyl)phosphane has a molecular weight of 416.49 g/mol, XLogP of 6.47, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylphosphane;tris(prop-2-enyl)phosphane is sourced from PubChem (CID 175264539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).