C25H33N — CID 142315139
4-tert-butyl-N-[(2Z)-2-tert-butylpenta-2,4-dienyl]-N-phenylaniline (PubChem CID 142315139) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2Z)-2-tert-butylpenta-2,4-dienyl]-N-phenylaniline.
| Compound Name | 4-tert-butyl-N-[(2Z)-2-tert-butylpenta-2,4-dienyl]-N-phenylaniline |
|---|---|
| PubChem CID | 142315139 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 4-tert-butyl-N-[(2Z)-2-tert-butylpenta-2,4-dienyl]-N-phenylaniline |
| SMILES | C=C/C=C(\CN(c1ccccc1)c1ccc(C(C)(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C25H33N/c1-8-12-21(25(5,6)7)19-26(22-13-10-9-11-14-22)23-17-15-20(16-18-23)24(2,3)4/h8-18H,1,19H2,2-7H3/b21-12+ |
| InChIKey | QTRNOPWTHBRIGV-CIAFOILYSA-N |
| XLogP | 7.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|