C28H30N2 — CID 155714746
(3E)-2-N-(4-tert-butylphenyl)-4-N,4-N-diphenylhexa-1,3,5-triene-2,4-diamine (PubChem CID 155714746) has the molecular formula C28H30N2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (3E)-2-N-(4-tert-butylphenyl)-4-N,4-N-diphenylhexa-1,3,5-triene-2,4-diamine.
| Compound Name | (3E)-2-N-(4-tert-butylphenyl)-4-N,4-N-diphenylhexa-1,3,5-triene-2,4-diamine |
|---|---|
| PubChem CID | 155714746 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (3E)-2-N-(4-tert-butylphenyl)-4-N,4-N-diphenylhexa-1,3,5-triene-2,4-diamine |
| SMILES | C=C/C(=C\C(=C)Nc1ccc(C(C)(C)C)cc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2/c1-6-25(21-22(2)29-24-19-17-23(18-20-24)28(3,4)5)30(26-13-9-7-10-14-26)27-15-11-8-12-16-27/h6-21,29H,1-2H2,3-5H3/b25-21+ |
| InChIKey | POSZSHWMBURBJC-NJNXFGOHSA-N |
| XLogP | 7.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|