C26H27N3O2S — CID 17230402
4-tert-butyl-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 17230402) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17230402 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-tert-butyl-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CN(C(=O)c1ccc(NC(=S)NC(=O)c2ccc(C(C)(C)C)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O2S/c1-26(2,3)20-14-10-18(11-15-20)23(30)28-25(32)27-21-16-12-19(13-17-21)24(31)29(4)22-8-6-5-7-9-22/h5-17H,1-4H3,(H2,27,28,30,32) |
| InChIKey | KVRHVNBASGZBOX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|