C22H17Cl2N3O2S — CID 17230375
2,4-dichloro-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 17230375) has the molecular formula C22H17Cl2N3O2S and a molecular weight of 458.37 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17230375 |
| Molecular Formula | C22H17Cl2N3O2S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 2,4-dichloro-N-[[4-[methyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CN(C(=O)c1ccc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H17Cl2N3O2S/c1-27(17-5-3-2-4-6-17)21(29)14-7-10-16(11-8-14)25-22(30)26-20(28)18-12-9-15(23)13-19(18)24/h2-13H,1H3,(H2,25,26,28,30) |
| InChIKey | CHYIMGDSPAWUIE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|