C19H22N2OS — CID 974411
4-tert-butyl-N-[methyl(phenyl)carbamothioyl]benzamide (PubChem CID 974411) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 4-tert-butyl-N-[methyl(phenyl)carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[methyl(phenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 974411 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-tert-butyl-N-[methyl(phenyl)carbamothioyl]benzamide |
| SMILES | CN(C(=S)NC(=O)c1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2OS/c1-19(2,3)15-12-10-14(11-13-15)17(22)20-18(23)21(4)16-8-6-5-7-9-16/h5-13H,1-4H3,(H,20,22,23) |
| InChIKey | LNTOHJUGFTWPBS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|