C11H13N — CID 143234839
N-buta-1,3-dien-2-yl-4-methylaniline (PubChem CID 143234839) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-4-methylaniline.
| Compound Name | N-buta-1,3-dien-2-yl-4-methylaniline |
|---|---|
| PubChem CID | 143234839 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-buta-1,3-dien-2-yl-4-methylaniline |
| SMILES | C=CC(=C)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C11H13N/c1-4-10(3)12-11-7-5-9(2)6-8-11/h4-8,12H,1,3H2,2H3 |
| InChIKey | BPSTURQYJAHSPJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|