C14H15NOS — CID 155719046
S-[(3E)-hexa-1,3,5-trien-3-yl] N-(4-methylphenyl)carbamothioate (PubChem CID 155719046) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is S-[(3E)-hexa-1,3,5-trien-3-yl] N-(4-methylphenyl)carbamothioate.
| Compound Name | S-[(3E)-hexa-1,3,5-trien-3-yl] N-(4-methylphenyl)carbamothioate |
|---|---|
| PubChem CID | 155719046 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | S-[(3E)-hexa-1,3,5-trien-3-yl] N-(4-methylphenyl)carbamothioate |
| SMILES | C=C/C=C(\C=C)SC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C14H15NOS/c1-4-6-13(5-2)17-14(16)15-12-9-7-11(3)8-10-12/h4-10H,1-2H2,3H3,(H,15,16)/b13-6+ |
| InChIKey | SSJCPPQTXIAKFD-AWNIVKPZSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|