C17H17NS — CID 167231081
N-buta-1,3-dien-2-yl-4-(4-methylphenyl)sulfanylaniline (PubChem CID 167231081) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-4-(4-methylphenyl)sulfanylaniline.
| Compound Name | N-buta-1,3-dien-2-yl-4-(4-methylphenyl)sulfanylaniline |
|---|---|
| PubChem CID | 167231081 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-buta-1,3-dien-2-yl-4-(4-methylphenyl)sulfanylaniline |
| SMILES | C=CC(=C)Nc1ccc(Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H17NS/c1-4-14(3)18-15-7-11-17(12-8-15)19-16-9-5-13(2)6-10-16/h4-12,18H,1,3H2,2H3 |
| InChIKey | NGRILHWWEYLFLM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|