C13H19N — CID 143234838
N-buta-1,3-dien-2-yl-4-methylaniline;ethane (PubChem CID 143234838) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-4-methylaniline;ethane.
| Compound Name | N-buta-1,3-dien-2-yl-4-methylaniline;ethane |
|---|---|
| PubChem CID | 143234838 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-buta-1,3-dien-2-yl-4-methylaniline;ethane |
| SMILES | C=CC(=C)Nc1ccc(C)cc1.CC |
| InChI | InChI=1S/C11H13N.C2H6/c1-4-10(3)12-11-7-5-9(2)6-8-11;1-2/h4-8,12H,1,3H2,2H3;1-2H3 |
| InChIKey | UQUCORIYLBHBIH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|