About (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane
(E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane (PubChem CID 143338859) has the molecular formula C15H22ClN3
and a molecular weight of 279.82 g/mol. Its IUPAC name is (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane.
Molecular Properties
| Compound Name | (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane |
| PubChem CID | 143338859 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.82 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane |
| SMILES | C=C(N)/N=C(\C=C(/C)Cl)Nc1ccc(C)cc1.CC |
| InChI | InChI=1S/C13H16ClN3.C2H6/c1-9-4-6-12(7-5-9)17-13(8-10(2)14)16-11(3)15;1-2/h4-8H,3,15H2,1-2H3,(H,16,17);1-2H3/b10-8+; |
| InChIKey | JBRDCYZUEIQKGX-VRTOBVRTSA-N |
| XLogP | 4.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane?
The IUPAC name of (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane (CID 143338859) is (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane.
What is the SMILES notation for (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane?
The canonical SMILES for (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane is C=C(N)/N=C(\C=C(/C)Cl)Nc1ccc(C)cc1.CC.
What is the InChIKey of (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane?
The InChIKey is JBRDCYZUEIQKGX-VRTOBVRTSA-N. The full InChI is InChI=1S/C13H16ClN3.C2H6/c1-9-4-6-12(7-5-9)17-13(8-10(2)14)16-11(3)15;1-2/h4-8H,3,15H2,1-2H3,(H,16,17);1-2H3/b10-8+;.
What are the key properties of (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane?
(E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane has a molecular weight of 279.82 g/mol, XLogP of 4.40, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(1-aminoethenyl)-3-chloro-N-(4-methylphenyl)but-2-enimidamide;ethane is sourced from PubChem (CID 143338859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).