C9H13N3 — CID 142512509
(E)-1-N'-(4-methylphenyl)ethene-1,1,2-triamine (PubChem CID 142512509) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is (E)-1-N'-(4-methylphenyl)ethene-1,1,2-triamine.
| Compound Name | (E)-1-N'-(4-methylphenyl)ethene-1,1,2-triamine |
|---|---|
| PubChem CID | 142512509 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (E)-1-N'-(4-methylphenyl)ethene-1,1,2-triamine |
| SMILES | Cc1ccc(N/C(N)=C/N)cc1 |
| InChI | InChI=1S/C9H13N3/c1-7-2-4-8(5-3-7)12-9(11)6-10/h2-6,12H,10-11H2,1H3/b9-6+ |
| InChIKey | GLYNTANNWNLTIJ-RMKNXTFCSA-N |
| XLogP | 1.12 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |