C25H31N — CID 142315144
4-tert-butyl-N-[(1Z)-3-tert-butylpenta-1,3,4-trienyl]-N-phenylaniline (PubChem CID 142315144) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[(1Z)-3-tert-butylpenta-1,3,4-trienyl]-N-phenylaniline.
| Compound Name | 4-tert-butyl-N-[(1Z)-3-tert-butylpenta-1,3,4-trienyl]-N-phenylaniline |
|---|---|
| PubChem CID | 142315144 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 4-tert-butyl-N-[(1Z)-3-tert-butylpenta-1,3,4-trienyl]-N-phenylaniline |
| SMILES | C=C=C(/C=C\N(c1ccccc1)c1ccc(C(C)(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C25H31N/c1-8-20(24(2,3)4)18-19-26(22-12-10-9-11-13-22)23-16-14-21(15-17-23)25(5,6)7/h9-19H,1H2,2-7H3/b19-18- |
| InChIKey | ZCXVIVLUMHJDJI-HNENSFHCSA-N |
| XLogP | 7.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|