C48H50N2 — CID 157179618
N-(4-tert-butylphenyl)-4-[(E)-3-[4-(N-(4-tert-butylphenyl)anilino)phenyl]but-2-en-2-yl]-N-phenylaniline (PubChem CID 157179618) has the molecular formula C48H50N2 and a molecular weight of 654.94 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-[(E)-3-[4-(N-(4-tert-butylphenyl)anilino)phenyl]but-2-en-2-yl]-N-phenylaniline.
| Compound Name | N-(4-tert-butylphenyl)-4-[(E)-3-[4-(N-(4-tert-butylphenyl)anilino)phenyl]but-2-en-2-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 157179618 |
| Molecular Formula | C48H50N2 |
| Molecular Weight | 654.94 g/mol |
| Exact Mass | 654.40 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-[(E)-3-[4-(N-(4-tert-butylphenyl)anilino)phenyl]but-2-en-2-yl]-N-phenylaniline |
| SMILES | C/C(=C(/C)c1ccc(N(c2ccccc2)c2ccc(C(C)(C)C)cc2)cc1)c1ccc(N(c2ccccc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C48H50N2/c1-35(37-19-27-43(28-20-37)49(41-15-11-9-12-16-41)45-31-23-39(24-32-45)47(3,4)5)36(2)38-21-29-44(30-22-38)50(42-17-13-10-14-18-42)46-33-25-40(26-34-46)48(6,7)8/h9-34H,1-8H3/b36-35+ |
| InChIKey | YYRQZDRPNMZZTL-ULDVOPSXSA-N |
| XLogP | 14.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.94 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|