C31H31NOS — CID 139493170
(4-tert-butylphenyl)-[4-(N-[4-(1-sulfanylethyl)phenyl]anilino)phenyl]methanone (PubChem CID 139493170) has the molecular formula C31H31NOS and a molecular weight of 465.66 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(N-[4-(1-sulfanylethyl)phenyl]anilino)phenyl]methanone.
| Compound Name | (4-tert-butylphenyl)-[4-(N-[4-(1-sulfanylethyl)phenyl]anilino)phenyl]methanone |
|---|---|
| PubChem CID | 139493170 |
| Molecular Formula | C31H31NOS |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(N-[4-(1-sulfanylethyl)phenyl]anilino)phenyl]methanone |
| SMILES | CC(S)c1ccc(N(c2ccccc2)c2ccc(C(=O)c3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H31NOS/c1-22(34)23-12-18-28(19-13-23)32(27-8-6-5-7-9-27)29-20-14-25(15-21-29)30(33)24-10-16-26(17-11-24)31(2,3)4/h5-22,34H,1-4H3 |
| InChIKey | MIRSHEQXFHNLJU-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|